C15H12N4O3 — CID 10827758
8-[(E)-2-(furan-2-yl)ethenyl]-3-methyl-1-prop-2-ynyl-7H-purine-2,6-dione (PubChem CID 10827758) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 8-[(E)-2-(furan-2-yl)ethenyl]-3-methyl-1-prop-2-ynyl-7H-purine-2,6-dione.
| Compound Name | 8-[(E)-2-(furan-2-yl)ethenyl]-3-methyl-1-prop-2-ynyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 10827758 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 8-[(E)-2-(furan-2-yl)ethenyl]-3-methyl-1-prop-2-ynyl-7H-purine-2,6-dione |
| SMILES | C#CCn1c(=O)c2[nH]c(/C=C/c3ccco3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H12N4O3/c1-3-8-19-14(20)12-13(18(2)15(19)21)17-11(16-12)7-6-10-5-4-9-22-10/h1,4-7,9H,8H2,2H3,(H,16,17)/b7-6+ |
| InChIKey | DXDNJRPYHNDGFH-VOTSOKGWSA-N |
| XLogP | 0.82 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|