C20H38OSi2 — CID 10937036
trimethyl-[(3S,5R)-2-methyl-5-prop-1-en-2-yl-3-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohexen-1-yl]oxysilane (PubChem CID 10937036) has the molecular formula C20H38OSi2 and a molecular weight of 350.70 g/mol. Its IUPAC name is trimethyl-[(3S,5R)-2-methyl-5-prop-1-en-2-yl-3-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[(3S,5R)-2-methyl-5-prop-1-en-2-yl-3-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 10937036 |
| Molecular Formula | C20H38OSi2 |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | trimethyl-[(3S,5R)-2-methyl-5-prop-1-en-2-yl-3-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohexen-1-yl]oxysilane |
| SMILES | C=C(C[C@@H]1C[C@@H](C(=C)C)CC(O[Si](C)(C)C)=C1C)C[Si](C)(C)C |
| InChI | InChI=1S/C20H38OSi2/c1-15(2)18-12-19(11-16(3)14-22(5,6)7)17(4)20(13-18)21-23(8,9)10/h18-19H,1,3,11-14H2,2,4-10H3/t18-,19-/m1/s1 |
| InChIKey | LWLDJMFCVPHQFQ-RTBURBONSA-N |
| XLogP | 7.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|