C18H24N4O2 — CID 109384603
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine (PubChem CID 109384603) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109384603 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ncc(-c2ccccc2)o1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C18H24N4O2/c1-19-18(22(2)12-14-8-9-23-13-14)21-11-17-20-10-16(24-17)15-6-4-3-5-7-15/h3-7,10,14H,8-9,11-13H2,1-2H3,(H,19,21) |
| InChIKey | CPSOSYLKKZJXJK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|