C23H33N5O2 — CID 109387281
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(2-pyridin-3-ylethyl)guanidine (PubChem CID 109387281) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(2-pyridin-3-ylethyl)guanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(2-pyridin-3-ylethyl)guanidine |
|---|---|
| PubChem CID | 109387281 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethyl-2-(2-pyridin-3-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCc1cccnc1)NC1CCN(c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-4-25-23(26-11-7-18-6-5-10-24-17-18)27-19-8-12-28(13-9-19)20-14-21(29-2)16-22(15-20)30-3/h5-6,10,14-17,19H,4,7-9,11-13H2,1-3H3,(H2,25,26,27) |
| InChIKey | XFKRAOZFDPZZDX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|