C24H41N5O2 — CID 109387597
2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine (PubChem CID 109387597) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine.
| Compound Name | 2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109387597 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 2-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCN(C(C)C)C1CC1)NC1CCN(c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C24H41N5O2/c1-6-25-24(26-11-14-29(18(2)3)20-7-8-20)27-19-9-12-28(13-10-19)21-15-22(30-4)17-23(16-21)31-5/h15-20H,6-14H2,1-5H3,(H2,25,26,27) |
| InChIKey | AGFQXZBKZLHERI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|