C20H26N2O3 — CID 109389475
N-(3-hydroxy-2,2,4-trimethylpentyl)-N'-naphthalen-2-yloxamide (PubChem CID 109389475) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-N'-naphthalen-2-yloxamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-N'-naphthalen-2-yloxamide |
|---|---|
| PubChem CID | 109389475 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-N'-naphthalen-2-yloxamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H26N2O3/c1-13(2)17(23)20(3,4)12-21-18(24)19(25)22-16-10-9-14-7-5-6-8-15(14)11-16/h5-11,13,17,23H,12H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | HZUVCCRSKJARFH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|