C19H29FIN3O — CID 109393347
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 109393347) has the molecular formula C19H29FIN3O and a molecular weight of 461.36 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109393347 |
| Molecular Formula | C19H29FIN3O |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C19H28FN3O.HI/c1-19(2,16-5-4-6-17(20)13-16)14-23-18(21-3)22-10-7-15-8-11-24-12-9-15;/h4-6,8,13H,7,9-12,14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | SPIDENWUCWENIU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|