C24H26O5S2 — CID 10939452
[6-[2-(benzenesulfonyl)cyclohex-2-en-1-yl]oxycyclohexen-1-yl]sulfonylbenzene (PubChem CID 10939452) has the molecular formula C24H26O5S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is [6-[2-(benzenesulfonyl)cyclohex-2-en-1-yl]oxycyclohexen-1-yl]sulfonylbenzene.
| Compound Name | [6-[2-(benzenesulfonyl)cyclohex-2-en-1-yl]oxycyclohexen-1-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 10939452 |
| Molecular Formula | C24H26O5S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [6-[2-(benzenesulfonyl)cyclohex-2-en-1-yl]oxycyclohexen-1-yl]sulfonylbenzene |
| SMILES | O=S(=O)(C1=CCCCC1OC1CCCC=C1S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O5S2/c25-30(26,19-11-3-1-4-12-19)23-17-9-7-15-21(23)29-22-16-8-10-18-24(22)31(27,28)20-13-5-2-6-14-20/h1-6,11-14,17-18,21-22H,7-10,15-16H2 |
| InChIKey | OFKMQKWGJWMKAV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |