C17H24N2O3 — CID 109399072
N-(3-ethylphenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide (PubChem CID 109399072) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(3-ethylphenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide.
| Compound Name | N-(3-ethylphenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 109399072 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-(3-ethylphenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide |
| SMILES | CCc1cccc(NC(=O)C(=O)N(C)CC2CCCC2O)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-3-12-6-4-8-14(10-12)18-16(21)17(22)19(2)11-13-7-5-9-15(13)20/h4,6,8,10,13,15,20H,3,5,7,9,11H2,1-2H3,(H,18,21) |
| InChIKey | GGIAWALINZPDPB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|