C15H17ClF2N2O3 — CID 109399026
N-(2-chloro-4,5-difluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide (PubChem CID 109399026) has the molecular formula C15H17ClF2N2O3 and a molecular weight of 346.76 g/mol. Its IUPAC name is N-(2-chloro-4,5-difluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide.
| Compound Name | N-(2-chloro-4,5-difluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 109399026 |
| Molecular Formula | C15H17ClF2N2O3 |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(2-chloro-4,5-difluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]-N'-methyloxamide |
| SMILES | CN(CC1CCCC1O)C(=O)C(=O)Nc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H17ClF2N2O3/c1-20(7-8-3-2-4-13(8)21)15(23)14(22)19-12-6-11(18)10(17)5-9(12)16/h5-6,8,13,21H,2-4,7H2,1H3,(H,19,22) |
| InChIKey | SNAXOPHOVKOEMR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|