C16H19F3N2O3 — CID 109399018
N'-[(2-hydroxycyclopentyl)methyl]-N'-methyl-N-[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 109399018) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N'-[(2-hydroxycyclopentyl)methyl]-N'-methyl-N-[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(2-hydroxycyclopentyl)methyl]-N'-methyl-N-[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 109399018 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N'-[(2-hydroxycyclopentyl)methyl]-N'-methyl-N-[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | CN(CC1CCCC1O)C(=O)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O3/c1-21(9-10-5-4-8-13(10)22)15(24)14(23)20-12-7-3-2-6-11(12)16(17,18)19/h2-3,6-7,10,13,22H,4-5,8-9H2,1H3,(H,20,23) |
| InChIKey | WFIGESPXVGOZJM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|