C19H29FIN5 — CID 109401750
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 109401750) has the molecular formula C19H29FIN5 and a molecular weight of 473.38 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109401750 |
| Molecular Formula | C19H29FIN5 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCc1c(CC)nn(C)c1CC.I |
| InChI | InChI=1S/C19H28FN5.HI/c1-5-17-16(18(6-2)25(4)24-17)13-23-19(21-7-3)22-12-14-8-10-15(20)11-9-14;/h8-11H,5-7,12-13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | OSLFUXKZJWMXCS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|