C20H32IN5O — CID 109402060
3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109402060) has the molecular formula C20H32IN5O and a molecular weight of 485.41 g/mol. Its IUPAC name is 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109402060 |
| Molecular Formula | C20H32IN5O |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C20H31N5O.HI/c1-7-17-16(18(8-2)25(5)23-17)13-22-20(21-3)24(4)14-15-11-9-10-12-19(15)26-6;/h9-12H,7-8,13-14H2,1-6H3,(H,21,22);1H |
| InChIKey | ARJMWVSPYOWWJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|