C17H28IN5S — CID 109402965
3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109402965) has the molecular formula C17H28IN5S and a molecular weight of 461.42 g/mol. Its IUPAC name is 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109402965 |
| Molecular Formula | C17H28IN5S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N/C)N(C)Cc1ccsc1.I |
| InChI | InChI=1S/C17H27N5S.HI/c1-6-15-14(16(7-2)22(5)20-15)10-19-17(18-3)21(4)11-13-8-9-23-12-13;/h8-9,12H,6-7,10-11H2,1-5H3,(H,18,19);1H |
| InChIKey | PMDBZDJOABGCIY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|