C17H30IN7 — CID 109402834
3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109402834) has the molecular formula C17H30IN7 and a molecular weight of 459.38 g/mol. Its IUPAC name is 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109402834 |
| Molecular Formula | C17H30IN7 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 3-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1,2-dimethyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N/C)N(C)Cc1cnn(C)c1.I |
| InChI | InChI=1S/C17H29N7.HI/c1-7-15-14(16(8-2)24(6)21-15)10-19-17(18-3)22(4)11-13-9-20-23(5)12-13;/h9,12H,7-8,10-11H2,1-6H3,(H,18,19);1H |
| InChIKey | KILGMTPHMLTXJW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|