C31H32FN3O3 — CID 10940210
5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-6-methoxy-2,2-dimethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile (PubChem CID 10940210) has the molecular formula C31H32FN3O3 and a molecular weight of 513.61 g/mol. Its IUPAC name is 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-6-methoxy-2,2-dimethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-6-methoxy-2,2-dimethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 10940210 |
| Molecular Formula | C31H32FN3O3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-6-methoxy-2,2-dimethyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
| SMILES | COC1=N[C@H](Cc2ccccc2)[C@@H]2OC(C)(C)O[C@H]2[C@@H](Cc2ccccc2)N1Cc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C31H32FN3O3/c1-31(2)37-28-26(17-21-10-6-4-7-11-21)34-30(36-3)35(20-23-14-15-25(32)24(16-23)19-33)27(29(28)38-31)18-22-12-8-5-9-13-22/h4-16,26-29H,17-18,20H2,1-3H3/t26-,27-,28+,29+/m1/s1 |
| InChIKey | DMXRBOPPQAIFCV-GKQHHHCTSA-N |
| XLogP | 5.26 |
| TPSA | 67.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |