C34H38FN3O3 — CID 59952989
5-[[(4R,8R)-4,8-dibenzyl-7-butyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile (PubChem CID 59952989) has the molecular formula C34H38FN3O3 and a molecular weight of 555.69 g/mol. Its IUPAC name is 5-[[(4R,8R)-4,8-dibenzyl-7-butyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(4R,8R)-4,8-dibenzyl-7-butyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 59952989 |
| Molecular Formula | C34H38FN3O3 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 5-[[(4R,8R)-4,8-dibenzyl-7-butyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
| SMILES | CCCCN1C(=O)N(Cc2ccc(F)c(C#N)c2)[C@H](Cc2ccccc2)C2OC(C)(C)OC2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C34H38FN3O3/c1-4-5-18-37-29(20-24-12-8-6-9-13-24)31-32(41-34(2,3)40-31)30(21-25-14-10-7-11-15-25)38(33(37)39)23-26-16-17-28(35)27(19-26)22-36/h6-17,19,29-32H,4-5,18,20-21,23H2,1-3H3/t29-,30-,31?,32?/m1/s1 |
| InChIKey | KDAOYQYFVBWPRP-NXFCCEIPSA-N |
| XLogP | 6.48 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |