C40H42FN3O4 — CID 59131675
5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-7-(3-phenylmethoxypropyl)-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile (PubChem CID 59131675) has the molecular formula C40H42FN3O4 and a molecular weight of 647.79 g/mol. Its IUPAC name is 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-7-(3-phenylmethoxypropyl)-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-7-(3-phenylmethoxypropyl)-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 59131675 |
| Molecular Formula | C40H42FN3O4 |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | 5-[[(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-6-oxo-7-(3-phenylmethoxypropyl)-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](Cc1ccccc1)N(Cc1ccc(F)c(C#N)c1)C(=O)N(CCCOCc1ccccc1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C40H42FN3O4/c1-40(2)47-37-35(24-29-13-6-3-7-14-29)43(21-12-22-46-28-31-17-10-5-11-18-31)39(45)44(27-32-19-20-34(41)33(23-32)26-42)36(38(37)48-40)25-30-15-8-4-9-16-30/h3-11,13-20,23,35-38H,12,21-22,24-25,27-28H2,1-2H3/t35-,36-,37+,38+/m1/s1 |
| InChIKey | XZPOZXWKBYOFRQ-RNATXAOGSA-N |
| XLogP | 7.28 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|