C32H34FN3O3 — CID 59953209
5-[[(4R,8R)-4,8-dibenzyl-7-ethyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile (PubChem CID 59953209) has the molecular formula C32H34FN3O3 and a molecular weight of 527.64 g/mol. Its IUPAC name is 5-[[(4R,8R)-4,8-dibenzyl-7-ethyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(4R,8R)-4,8-dibenzyl-7-ethyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 59953209 |
| Molecular Formula | C32H34FN3O3 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 5-[[(4R,8R)-4,8-dibenzyl-7-ethyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]-2-fluorobenzonitrile |
| SMILES | CCN1C(=O)N(Cc2ccc(F)c(C#N)c2)[C@H](Cc2ccccc2)C2OC(C)(C)OC2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C32H34FN3O3/c1-4-35-27(18-22-11-7-5-8-12-22)29-30(39-32(2,3)38-29)28(19-23-13-9-6-10-14-23)36(31(35)37)21-24-15-16-26(33)25(17-24)20-34/h5-17,27-30H,4,18-19,21H2,1-3H3/t27-,28-,29?,30?/m1/s1 |
| InChIKey | GXPKQTSYYMMEOA-FSOBKABBSA-N |
| XLogP | 5.70 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |