C37H36FN3O3 — CID 59953203
2-fluoro-5-[[(4R,8R)-4,7,8-tribenzyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]benzonitrile (PubChem CID 59953203) has the molecular formula C37H36FN3O3 and a molecular weight of 589.71 g/mol. Its IUPAC name is 2-fluoro-5-[[(4R,8R)-4,7,8-tribenzyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[(4R,8R)-4,7,8-tribenzyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 59953203 |
| Molecular Formula | C37H36FN3O3 |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 2-fluoro-5-[[(4R,8R)-4,7,8-tribenzyl-2,2-dimethyl-6-oxo-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-5-yl]methyl]benzonitrile |
| SMILES | CC1(C)OC2C(O1)[C@@H](Cc1ccccc1)N(Cc1ccc(F)c(C#N)c1)C(=O)N(Cc1ccccc1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C37H36FN3O3/c1-37(2)43-34-32(21-26-12-6-3-7-13-26)40(24-28-16-10-5-11-17-28)36(42)41(25-29-18-19-31(38)30(20-29)23-39)33(35(34)44-37)22-27-14-8-4-9-15-27/h3-20,32-35H,21-22,24-25H2,1-2H3/t32-,33-,34?,35?/m1/s1 |
| InChIKey | KMQTUHVQGADKQN-MIXHAXSFSA-N |
| XLogP | 6.88 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |