C20H28F2IN3O — CID 109402479
1-[1-(3,4-difluorophenyl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109402479) has the molecular formula C20H28F2IN3O and a molecular weight of 491.36 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109402479 |
| Molecular Formula | C20H28F2IN3O |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | C/N=C(\NC(C)c1ccc(F)c(F)c1)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C20H27F2N3O.HI/c1-12(13-5-6-15(21)16(22)11-13)24-19(23-2)25-17-14-7-10-26-18(14)20(17)8-3-4-9-20;/h5-6,11-12,14,17-18H,3-4,7-10H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | HDZDNYIRUPIEGF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|