C19H28F2IN3O — CID 119161415
1-[1-(2,4-difluorophenyl)ethyl]-3-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methylguanidine;hydroiodide (PubChem CID 119161415) has the molecular formula C19H28F2IN3O and a molecular weight of 479.35 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)ethyl]-3-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119161415 |
| Molecular Formula | C19H28F2IN3O |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NC(C)c1ccc(F)cc1F)NC1C2CCCOC2C1(C)C.I |
| InChI | InChI=1S/C19H27F2N3O.HI/c1-11(13-8-7-12(20)10-15(13)21)23-18(22-4)24-16-14-6-5-9-25-17(14)19(16,2)3;/h7-8,10-11,14,16-17H,5-6,9H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | JFRGNVWFJAJDCM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|