C21H37IN6O — CID 109404352
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 109404352) has the molecular formula C21H37IN6O and a molecular weight of 516.47 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109404352 |
| Molecular Formula | C21H37IN6O |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NCc1cc(C(CC)CC)no1.I |
| InChI | InChI=1S/C21H36N6O.HI/c1-7-15(8-2)19-12-16(28-26-19)13-23-21(22-11-5)24-14-17-18(9-3)25-27(6)20(17)10-4;/h12,15H,7-11,13-14H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | UCDSJIRXHGFPDG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|