C22H30FIN4O — CID 109407305
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109407305) has the molecular formula C22H30FIN4O and a molecular weight of 512.41 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109407305 |
| Molecular Formula | C22H30FIN4O |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c[nH]c2ccc(F)cc12)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C22H29FN4O.HI/c1-24-21(25-10-6-14-13-26-18-5-4-15(23)12-17(14)18)27-19-16-7-11-28-20(16)22(19)8-2-3-9-22;/h4-5,12-13,16,19-20,26H,2-3,6-11H2,1H3,(H2,24,25,27);1H |
| InChIKey | HYSPHAJPONYVIC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|