About phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate)
phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) (PubChem CID 10941368) has the molecular formula C18H15F6IN2O6S2
and a molecular weight of 660.35 g/mol. Its IUPAC name is phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) |
| PubChem CID | 10941368 |
| Molecular Formula | C18H15F6IN2O6S2 |
| Molecular Weight | 660.35 g/mol |
| Exact Mass | 659.93 |
| IUPAC Name | phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.c1ccc(I([n+]2ccccc2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C16H15IN2.2CHF3O3S/c1-4-10-16(11-5-1)17(18-12-6-2-7-13-18)19-14-8-3-9-15-19;2*2-1(3,4)8(5,6)7/h1-15H;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | JDMNSSBAUBJNJO-UHFFFAOYSA-L |
| XLogP | 2.97 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 660.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate)?
The IUPAC name of phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) (CID 10941368) is phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate).
What is the SMILES notation for phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate)?
The canonical SMILES for phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) is O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.c1ccc(I([n+]2ccccc2)[n+]2ccccc2)cc1.
What is the InChIKey of phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate)?
The InChIKey is JDMNSSBAUBJNJO-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H15IN2.2CHF3O3S/c1-4-10-16(11-5-1)17(18-12-6-2-7-13-18)19-14-8-3-9-15-19;2*2-1(3,4)8(5,6)7/h1-15H;2*(H,5,6,7)/q+2;;/p-2.
What are the key properties of phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate)?
phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) has a molecular weight of 660.35 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-di(pyridin-1-ium-1-yl)-λ3-iodane;bis(trifluoromethanesulfonate) is sourced from PubChem (CID 10941368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).