C17H14F2N2O2 — CID 109416581
1-(2,4-difluorophenyl)-2-(3-imidazol-1-ylphenoxy)ethanol (PubChem CID 109416581) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(3-imidazol-1-ylphenoxy)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(3-imidazol-1-ylphenoxy)ethanol |
|---|---|
| PubChem CID | 109416581 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(3-imidazol-1-ylphenoxy)ethanol |
| SMILES | OC(COc1cccc(-n2ccnc2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N2O2/c18-12-4-5-15(16(19)8-12)17(22)10-23-14-3-1-2-13(9-14)21-7-6-20-11-21/h1-9,11,17,22H,10H2 |
| InChIKey | HRQAMGWWCHCINQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |