C17H31IN4OS — CID 109423031
2-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423031) has the molecular formula C17H31IN4OS and a molecular weight of 466.43 g/mol. Its IUPAC name is 2-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423031 |
| Molecular Formula | C17H31IN4OS |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-ethyl-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CC(C)(OC)C1(C)C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C17H30N4OS.HI/c1-8-18-15(21(6)10-13-11-23-12(2)19-13)20-14-9-17(5,22-7)16(14,3)4;/h11,14H,8-10H2,1-7H3,(H,18,20);1H |
| InChIKey | WEAJRJGJBMRCQY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|