C9H12S — CID 10942649
2-ethynyl-4,5-dimethyl-3,6-dihydro-2H-thiopyran (PubChem CID 10942649) has the molecular formula C9H12S and a molecular weight of 152.26 g/mol. Its IUPAC name is 2-ethynyl-4,5-dimethyl-3,6-dihydro-2H-thiopyran.
| Compound Name | 2-ethynyl-4,5-dimethyl-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 10942649 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 2-ethynyl-4,5-dimethyl-3,6-dihydro-2H-thiopyran |
| SMILES | C#CC1CC(C)=C(C)CS1 |
| InChI | InChI=1S/C9H12S/c1-4-9-5-7(2)8(3)6-10-9/h1,9H,5-6H2,2-3H3 |
| InChIKey | NTEAOELDLKLQBP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|