C10H12S — CID 130315087
5-[(Z)-but-1-en-3-ynyl]-6-methyl-3,4-dihydro-2H-thiopyran (PubChem CID 130315087) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 5-[(Z)-but-1-en-3-ynyl]-6-methyl-3,4-dihydro-2H-thiopyran.
| Compound Name | 5-[(Z)-but-1-en-3-ynyl]-6-methyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 130315087 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 5-[(Z)-but-1-en-3-ynyl]-6-methyl-3,4-dihydro-2H-thiopyran |
| SMILES | C#C/C=C\C1=C(C)SCCC1 |
| InChI | InChI=1S/C10H12S/c1-3-4-6-10-7-5-8-11-9(10)2/h1,4,6H,5,7-8H2,2H3/b6-4- |
| InChIKey | HKQBBKYGBSXBLR-XQRVVYSFSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|