C23H28N6O2 — CID 109427085
N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109427085) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427085 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nc(-c2ccc(OC)cc2)n[nH]1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N6O2/c1-24-23(29-14-12-20(13-15-29)31-19-6-4-3-5-7-19)25-16-21-26-22(28-27-21)17-8-10-18(30-2)11-9-17/h3-11,20H,12-16H2,1-2H3,(H,24,25)(H,26,27,28) |
| InChIKey | ASROACHUHBPHAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|