C19H27IN6O3 — CID 111254870
methyl 1-[N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254870) has the molecular formula C19H27IN6O3 and a molecular weight of 514.37 g/mol. Its IUPAC name is methyl 1-[N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254870 |
| Molecular Formula | C19H27IN6O3 |
| Molecular Weight | 514.37 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | methyl 1-[N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccc(OC)cc2)n[nH]1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C19H26N6O3.HI/c1-20-19(25-10-8-14(9-11-25)18(26)28-3)21-12-16-22-17(24-23-16)13-4-6-15(27-2)7-5-13;/h4-7,14H,8-12H2,1-3H3,(H,20,21)(H,22,23,24);1H |
| InChIKey | PXXLXPZJGAMQRP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|