C21H28N8O — CID 109428057
N'-methyl-N-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109428057) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is N'-methyl-N-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109428057 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N'-methyl-N-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N8O/c1-22-21(29-12-8-17(9-13-29)30-16-6-4-3-5-7-16)24-11-10-23-19-18-14-27-28(2)20(18)26-15-25-19/h3-7,14-15,17H,8-13H2,1-2H3,(H,22,24)(H,23,25,26) |
| InChIKey | UEGHHONBUOVMHC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|