C18H31N7O4S — CID 109432617
N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-oxopiperazine-1-carboximidamide (PubChem CID 109432617) has the molecular formula C18H31N7O4S and a molecular weight of 441.56 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109432617 |
| Molecular Formula | C18H31N7O4S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(oxan-2-ylmethylsulfamoyl)ethyl]-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)(=O)NCC1CCCCO1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H31N7O4S/c1-19-18(20-6-10-30(27,28)22-12-16-5-3-4-9-29-16)24-7-8-25(17(26)14-24)15-11-21-23(2)13-15/h11,13,16,22H,3-10,12,14H2,1-2H3,(H,19,20) |
| InChIKey | XPHGGDPEXUGDFM-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|