C20H28FN7O — CID 109433137
N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433137) has the molecular formula C20H28FN7O and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433137 |
| Molecular Formula | C20H28FN7O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN(C)Cc1ccc(F)cc1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C20H28FN7O/c1-22-20(23-8-9-25(2)13-16-4-6-17(21)7-5-16)27-10-11-28(19(29)15-27)18-12-24-26(3)14-18/h4-7,12,14H,8-11,13,15H2,1-3H3,(H,22,23) |
| InChIKey | BWMOGWFUZWGCTG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|