C19H26ClIN6OS — CID 109433206
N-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109433206) has the molecular formula C19H26ClIN6OS and a molecular weight of 548.88 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109433206 |
| Molecular Formula | C19H26ClIN6OS |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-methylsulfanylethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(SC)c1cccc(Cl)c1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C19H25ClN6OS.HI/c1-21-19(22-11-17(28-3)14-5-4-6-15(20)9-14)25-7-8-26(18(27)13-25)16-10-23-24(2)12-16;/h4-6,9-10,12,17H,7-8,11,13H2,1-3H3,(H,21,22);1H |
| InChIKey | FSGJQPYJWLFGCK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|