C22H31N7O2 — CID 109433413
N'-methyl-4-(1-methylpyrazol-4-yl)-N-(2-morpholin-4-yl-2-phenylethyl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433413) has the molecular formula C22H31N7O2 and a molecular weight of 425.54 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-N-(2-morpholin-4-yl-2-phenylethyl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-(2-morpholin-4-yl-2-phenylethyl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433413 |
| Molecular Formula | C22H31N7O2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-(2-morpholin-4-yl-2-phenylethyl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccccc1)N1CCOCC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C22H31N7O2/c1-23-22(28-8-9-29(21(30)17-28)19-14-25-26(2)16-19)24-15-20(18-6-4-3-5-7-18)27-10-12-31-13-11-27/h3-7,14,16,20H,8-13,15,17H2,1-2H3,(H,23,24) |
| InChIKey | CXPCPXOPRFGSQG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|