C20H24N8O — CID 109433249
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 109433249) has the molecular formula C20H24N8O and a molecular weight of 392.47 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433249 |
| Molecular Formula | C20H24N8O |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1-n1cccn1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C20H24N8O/c1-21-20(22-12-16-6-3-4-7-18(16)28-9-5-8-23-28)26-10-11-27(19(29)15-26)17-13-24-25(2)14-17/h3-9,13-14H,10-12,15H2,1-2H3,(H,21,22) |
| InChIKey | UNWRBMAIGOCTLL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|