C22H33IN6O2 — CID 109433374
N'-methyl-N-[[2-(3-methylbutoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109433374) has the molecular formula C22H33IN6O2 and a molecular weight of 540.45 g/mol. Its IUPAC name is N'-methyl-N-[[2-(3-methylbutoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[[2-(3-methylbutoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109433374 |
| Molecular Formula | C22H33IN6O2 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N'-methyl-N-[[2-(3-methylbutoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OCCC(C)C)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C22H32N6O2.HI/c1-17(2)9-12-30-20-8-6-5-7-18(20)13-24-22(23-3)27-10-11-28(21(29)16-27)19-14-25-26(4)15-19;/h5-8,14-15,17H,9-13,16H2,1-4H3,(H,23,24);1H |
| InChIKey | CMLOXLSSFVEGAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|