C23H27N7O2 — CID 109435087
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-phenylmethoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 109435087) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-phenylmethoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-phenylmethoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435087 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(2-phenylmethoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccnc(OCc2ccccc2)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C23H27N7O2/c1-24-23(29-10-11-30(22(31)16-29)20-14-27-28(2)15-20)26-13-19-8-9-25-21(12-19)32-17-18-6-4-3-5-7-18/h3-9,12,14-15H,10-11,13,16-17H2,1-2H3,(H,24,26) |
| InChIKey | JBBDBJIVCIRKBB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|