C21H40N4O3S — CID 109437207
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine (PubChem CID 109437207) has the molecular formula C21H40N4O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109437207 |
| Molecular Formula | C21H40N4O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C1CCOC1)N1CCOCC1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C21H40N4O3S/c1-3-22-21(24-18-6-5-7-19(14-18)29(26)4-2)23-15-20(17-8-11-28-16-17)25-9-12-27-13-10-25/h17-20H,3-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | BLDVXKWBDZVWGZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|