C25H40IN3O3 — CID 109449516
N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449516) has the molecular formula C25H40IN3O3 and a molecular weight of 557.52 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449516 |
| Molecular Formula | C25H40IN3O3 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-ethyl-N'-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccccc2OC)CC1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C25H39N3O3.HI/c1-3-26-24(27-19-25(13-14-25)22-9-4-5-10-23(22)29-2)28-15-11-20(12-16-28)31-18-21-8-6-7-17-30-21;/h4-5,9-10,20-21H,3,6-8,11-19H2,1-2H3,(H,26,27);1H |
| InChIKey | CEEVHKCOKKMJDE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|