C17H22O2 — CID 10945120
(4aS,4bS,8aR,10aS)-8-methoxy-3,10a-dimethyl-1,2,4a,4b,8a,10-hexahydrophenanthren-9-one (PubChem CID 10945120) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4aS,4bS,8aR,10aS)-8-methoxy-3,10a-dimethyl-1,2,4a,4b,8a,10-hexahydrophenanthren-9-one.
| Compound Name | (4aS,4bS,8aR,10aS)-8-methoxy-3,10a-dimethyl-1,2,4a,4b,8a,10-hexahydrophenanthren-9-one |
|---|---|
| PubChem CID | 10945120 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4aS,4bS,8aR,10aS)-8-methoxy-3,10a-dimethyl-1,2,4a,4b,8a,10-hexahydrophenanthren-9-one |
| SMILES | COC1=CC=C[C@@H]2[C@H]1C(=O)C[C@]1(C)CCC(C)=C[C@H]21 |
| InChI | InChI=1S/C17H22O2/c1-11-7-8-17(2)10-14(18)16-12(13(17)9-11)5-4-6-15(16)19-3/h4-6,9,12-13,16H,7-8,10H2,1-3H3/t12-,13+,16-,17-/m0/s1 |
| InChIKey | VYILWCIPETXOMJ-RMHZUWNSSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|