C14H29N3S — CID 109452395
N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylsulfanylpropyl)azetidine-1-carboximidamide (PubChem CID 109452395) has the molecular formula C14H29N3S and a molecular weight of 271.47 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylsulfanylpropyl)azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylsulfanylpropyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452395 |
| Molecular Formula | C14H29N3S |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylsulfanylpropyl)azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCSC)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C14H29N3S/c1-7-15-12(16-9-8-10-18-6)17-11-13(2,3)14(17,4)5/h7-11H2,1-6H3,(H,15,16) |
| InChIKey | SXUHJPHHDAGWJH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|