C14H30IN3S — CID 109452914
N',2,2,3,3-pentamethyl-N-(4-methylsulfanylbutyl)azetidine-1-carboximidamide;hydroiodide (PubChem CID 109452914) has the molecular formula C14H30IN3S and a molecular weight of 399.39 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(4-methylsulfanylbutyl)azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(4-methylsulfanylbutyl)azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452914 |
| Molecular Formula | C14H30IN3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(4-methylsulfanylbutyl)azetidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCSC)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C14H29N3S.HI/c1-13(2)11-17(14(13,3)4)12(15-5)16-9-7-8-10-18-6;/h7-11H2,1-6H3,(H,15,16);1H |
| InChIKey | PLQJNSRRILMHDI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|