C13H26FN3 — CID 109453092
N-ethyl-N'-(3-fluoropropyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide (PubChem CID 109453092) has the molecular formula C13H26FN3 and a molecular weight of 243.37 g/mol. Its IUPAC name is N-ethyl-N'-(3-fluoropropyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(3-fluoropropyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453092 |
| Molecular Formula | C13H26FN3 |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | N-ethyl-N'-(3-fluoropropyl)-2,2,3,3-tetramethylazetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCF)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C13H26FN3/c1-6-15-11(16-9-7-8-14)17-10-12(2,3)13(17,4)5/h6-10H2,1-5H3,(H,15,16) |
| InChIKey | PAVWLCCUZRLLPY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|