benzyl 2-oxo-3-phenylmorpholine-4-carboxylate

C18H17NO4 — CID 10946862

IUPACbenzyl 2-oxo-3-phenylmorpholine-4-carboxylate
SMILESO=C1OCCN(C(=O)OCc2ccccc2)C1c1ccccc1
InChIInChI=1S/C18H17NO4/c20-17-16(15-9-5-2-6-10-15)19(11-12-22-17)18(21)23-13-14-7-3-1-4-8-14/h1-10,16H,11-13H2
InChIKeyLGRKTPUWLDJQTJ-UHFFFAOYSA-N
MW311.34 g/mol
LogP2.92
Rot. Bonds3

About benzyl 2-oxo-3-phenylmorpholine-4-carboxylate

benzyl 2-oxo-3-phenylmorpholine-4-carboxylate (PubChem CID 10946862) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is benzyl 2-oxo-3-phenylmorpholine-4-carboxylate.

Molecular Properties

Compound Namebenzyl 2-oxo-3-phenylmorpholine-4-carboxylate
PubChem CID10946862
Molecular FormulaC18H17NO4
Molecular Weight311.34 g/mol
Exact Mass311.12
IUPAC Namebenzyl 2-oxo-3-phenylmorpholine-4-carboxylate
SMILESO=C1OCCN(C(=O)OCc2ccccc2)C1c1ccccc1
InChIInChI=1S/C18H17NO4/c20-17-16(15-9-5-2-6-10-15)19(11-12-22-17)18(21)23-13-14-7-3-1-4-8-14/h1-10,16H,11-13H2
InChIKeyLGRKTPUWLDJQTJ-UHFFFAOYSA-N
XLogP2.92
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.34
LogP ≤ 52.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2-oxo-3-phenylmorpholine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-oxo-3-phenylmorpholine-4-carboxylate?
The IUPAC name of benzyl 2-oxo-3-phenylmorpholine-4-carboxylate (CID 10946862) is benzyl 2-oxo-3-phenylmorpholine-4-carboxylate.
What is the SMILES notation for benzyl 2-oxo-3-phenylmorpholine-4-carboxylate?
The canonical SMILES for benzyl 2-oxo-3-phenylmorpholine-4-carboxylate is O=C1OCCN(C(=O)OCc2ccccc2)C1c1ccccc1.
What is the InChIKey of benzyl 2-oxo-3-phenylmorpholine-4-carboxylate?
The InChIKey is LGRKTPUWLDJQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4/c20-17-16(15-9-5-2-6-10-15)19(11-12-22-17)18(21)23-13-14-7-3-1-4-8-14/h1-10,16H,11-13H2.
What are the key properties of benzyl 2-oxo-3-phenylmorpholine-4-carboxylate?
benzyl 2-oxo-3-phenylmorpholine-4-carboxylate has a molecular weight of 311.34 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-oxo-3-phenylmorpholine-4-carboxylate is sourced from PubChem (CID 10946862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).