C17H31F3N4O2 — CID 109472251
tert-butyl 3-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 109472251) has the molecular formula C17H31F3N4O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is tert-butyl 3-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109472251 |
| Molecular Formula | C17H31F3N4O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | tert-butyl 3-[[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCCN(C(=O)OC(C)(C)C)C1)NCCC(F)(F)F |
| InChI | InChI=1S/C17H31F3N4O2/c1-5-21-14(22-9-8-17(18,19)20)23-11-13-7-6-10-24(12-13)15(25)26-16(2,3)4/h13H,5-12H2,1-4H3,(H2,21,22,23) |
| InChIKey | GYTORQYAPVVAKF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|