C11H22F3IN4O — CID 109472544
3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 109472544) has the molecular formula C11H22F3IN4O and a molecular weight of 410.22 g/mol. Its IUPAC name is 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109472544 |
| Molecular Formula | C11H22F3IN4O |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCCC(F)(F)F.I |
| InChI | InChI=1S/C11H21F3N4O.HI/c1-4-16-9(17-6-5-11(12,13)14)18-7-10(2,3)8(15)19;/h4-7H2,1-3H3,(H2,15,19)(H2,16,17,18);1H |
| InChIKey | JAAWMEPZFFYOCM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|