C11H21F3N4O — CID 109472755
N,2,2-trimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide (PubChem CID 109472755) has the molecular formula C11H21F3N4O and a molecular weight of 282.31 g/mol. Its IUPAC name is N,2,2-trimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide.
| Compound Name | N,2,2-trimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109472755 |
| Molecular Formula | C11H21F3N4O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N,2,2-trimethyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC(C)(C)C(=O)NC |
| InChI | InChI=1S/C11H21F3N4O/c1-10(2,8(19)15-3)7-18-9(16-4)17-6-5-11(12,13)14/h5-7H2,1-4H3,(H,15,19)(H2,16,17,18) |
| InChIKey | GEGISBQBSQIYEF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|