C14H25F3N4O — CID 109473915
N-cyclohexyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide (PubChem CID 109473915) has the molecular formula C14H25F3N4O and a molecular weight of 322.38 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 109473915 |
| Molecular Formula | C14H25F3N4O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NCCC(F)(F)F |
| InChI | InChI=1S/C14H25F3N4O/c1-2-18-13(19-9-8-14(15,16)17)20-10-12(22)21-11-6-4-3-5-7-11/h11H,2-10H2,1H3,(H,21,22)(H2,18,19,20) |
| InChIKey | BTDBOBYEBBHDIK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|